CymitQuimica logo

CAS 29736-75-2

:

2,5,7,10,11,14-Hexaoxa-1,6-distibabicyclo[4.4.4]tetradecane

Description:
2,5,7,10,11,14-Hexaoxa-1,6-distibabicyclo[4.4.4]tetradecane is a complex organometallic compound characterized by its unique bicyclic structure that incorporates both oxygen and antimony atoms. The presence of six ether-like oxygen atoms contributes to its potential solubility in polar solvents, while the antimony atoms may impart specific electronic properties, making it of interest in various chemical applications. This compound is likely to exhibit interesting coordination chemistry due to the presence of antimony, which can form various oxidation states. Its structural configuration suggests potential uses in materials science, particularly in the development of novel polymers or as a ligand in coordination chemistry. Additionally, the compound's stability and reactivity would depend on the surrounding conditions, such as temperature and the presence of other reactive species. Overall, 2,5,7,10,11,14-Hexaoxa-1,6-distibabicyclo[4.4.4]tetradecane represents a fascinating area of study within organometallic chemistry, with potential implications in both theoretical and applied research.
Formula:C6H12O6Sb2
InChI:InChI=1S/3C2H4O2.2Sb/c3*3-1-2-4;;/h3*1-2H2;;/q3*-2;2*+3
InChI key:InChIKey=JEPVJCOLPSALKN-UHFFFAOYSA-N
SMILES:[Sb]12OCCO[Sb](OCCO1)OCCO2
Synonyms:
  • 1,2-Ethanediol, Antimony Salt (3:2)
  • 2,5,7,10,11,14-Hexaoxa-1,6-distibabicyclo(4.4.4)tetradecane
  • Antimony ethylene glycolate
  • Antimony ethylene glycoxide
  • Antimony tris(ethylene glycoxide)
  • Antimony, tris[ethylene glycolato(2-)]di-
  • Diantimony tris(ethylene glycolate)
  • Ethylene antimonate(III)
  • Ethylene glycol antimony
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.