CAS 2974-94-9

1-iodo-4-(2-phenoxyphenyl)benzene

Description:

1-Iodo-4-(2-phenoxyphenyl)benzene, with the CAS number 2974-94-9, is an organic compound characterized by its structure, which includes an iodine atom attached to a benzene ring that is further substituted with a phenoxyphenyl group. This compound typically exhibits properties common to aromatic compounds, such as stability and relatively low reactivity under standard conditions. The presence of the iodine atom can influence its reactivity, making it a potential candidate for nucleophilic substitution reactions. Additionally, the phenoxyphenyl substituent can enhance the compound's solubility in organic solvents and may impart specific electronic properties due to resonance effects. This compound may be utilized in various applications, including organic synthesis and materials science, particularly in the development of functionalized polymers or as intermediates in the synthesis of more complex molecules. Its physical properties, such as melting point and boiling point, would depend on the specific molecular interactions and the overall molecular weight. Safety data should be consulted for handling and storage, as iodine-containing compounds can pose health risks.

Formula: C₁₈H₁₃IO

InChI: InChI=1/C18H13IO/c19-15-12-10-14(11-13-15)17-8-4-5-9-18(17)20-16-6-2-1-3-7-16/h1-13H

SMILES: c1ccc(cc1)Oc1ccccc1c1ccc(cc1)I

Benzene, 1-iodo-4-phenoxy-

CAS: 2974-94-9

Formula: C₁₂H₉IO

Purity: 97%

Color and Shape: Solid

Molecular weight: 296.1037

Ref: IN-DA002Z9U

1-Iodo-4-phenoxy-benzene

CAS: 2974-94-9

1-Iodo-4-phenoxy-benzene

Purity: 98%

Molecular weight: 296.10g/mol

Ref: 54-OR452072

4-Iododiphenyl ether

CAS: 2974-94-9

Formula: C₁₂H₉IO

Purity: 97%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 296.107

Ref: 10-F148100