CAS 29741-10-4
:Luteolin 7-O-glucuronide
Description:
Luteolin 7-O-glucuronide is a flavonoid glycoside, a derivative of luteolin, which is known for its antioxidant and anti-inflammatory properties. This compound features a luteolin backbone with a glucuronic acid moiety attached at the 7-position, enhancing its solubility and bioavailability. It is commonly found in various plants, particularly in fruits, vegetables, and herbs, contributing to their health benefits. Luteolin 7-O-glucuronide exhibits potential pharmacological activities, including anti-cancer, anti-allergic, and neuroprotective effects, making it of interest in nutritional and medicinal research. Its structure allows it to interact with various biological pathways, influencing cellular processes. The compound is typically studied for its role in promoting health and preventing diseases, and it may also serve as a marker for the consumption of luteolin-rich foods. As with many flavonoids, its bioactivity can be influenced by factors such as metabolism, dosage, and the presence of other compounds in the diet.
Formula:C21H18O12
InChI:InChI=1S/C21H18O12/c22-9-2-1-7(3-10(9)23)13-6-12(25)15-11(24)4-8(5-14(15)32-13)31-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-24,26-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1
InChI key:InChIKey=VSUOKLTVXQRUSG-ZFORQUDYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(O)=C(O)C=C3)=CC(O[C@@H]4O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]4O)=CC2O
Synonyms:- Luteolin 7-glucuronide
- Flavone, 3′,4′,5,7-tetrahydroxy-, 7-β-D-glucopyranuronoside
- β-D-Glucopyranosiduronic acid, 2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-1-benzopyran-7-yl
- 2-(3,4-Dihydroxyphenyl)-5-hydroxy-4-oxo-4H-1-benzopyran-7-yl β-D-glucopyranosiduronic acid
- Glucopyranosiduronic acid, 2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-1-benzopyran-7-yl, β-D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Luteolin-7-O-glucuronide
CAS:Luteolin-7-O-glucuronide analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C21H18O12Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:462.37Luteolin-7-O-β-glucuronide
CAS:Formula:C21H18O12Color and Shape:Pale Yellow SolidMolecular weight:462.36Luteolin 7-glucuronide
CAS:Luteolin-7-O-glucuronide has anti-inflammatory activity. Luteolin 7-O-glucuronide shows potent α-glucosidase inhibitory effect with IC50 values of 14.7 uM, it also exhibits moderate α-amylase activity with IC50 values 61.5uM.Luteolin 7-O-glucuronide could inhibit Matrix Metalloproteinases (MMP) activities, with IC50s of 17.63, 7.99, 11.42, 12.85, 0.03 μM for MMP-1, MMP-3, MMP-8, MMP-9, MMP-13, respectively.Formula:C21H18O12Purity:95%~99%Color and Shape:Yellow powderMolecular weight:462.363Luteolin 7-O-glucuronide
CAS:Luteolin 7-O-glucuronide (Luteolin-7-glucuronide) possesses antioxidant activities.Formula:C21H18O12Purity:98% - 99.43%Color and Shape:SolidMolecular weight:462.36Luteolin 7-glucuronide
CAS:Natural glycosideFormula:C21H18O12Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:462.37Luteolin-7-glucuronide
CAS:<p>Luteolin-7-glucuronide is a flavonoid glucuronide, which is a metabolite of luteolin found in various plants. It is a naturally occurring compound sourced primarily from herbs and vegetables such as celery, parsley, and artichokes. Its mode of action involves the modulation of oxidative stress and inflammation through its capacity to scavenge free radicals and inhibit inflammatory pathways. This compound exerts its effects by modulating signaling pathways, such as NF-κB and MAPK, contributing to its anti-inflammatory properties.</p>Formula:C21H18O12Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:462.36 g/mol
