CAS 29743-97-3
:cis-10-Heptadecenoic acid
Description:
Cis-10-Heptadecenoic acid, also known as cis-10-heptadecenoate, is a monounsaturated fatty acid characterized by a long hydrocarbon chain with a double bond located at the 10th carbon from the carboxylic acid end. Its molecular formula is C17H32O2, and it features a cis configuration, which influences its physical properties and biological activity. This fatty acid is typically found in various natural sources, including certain plant oils and animal fats. It is known for its role in lipid metabolism and may have implications in nutrition and health. The presence of the double bond contributes to its fluidity and reactivity compared to saturated fatty acids. In terms of physical properties, cis-10-heptadecenoic acid is likely to be a liquid at room temperature, exhibiting lower melting points than its saturated counterparts. Its CAS number, 29743-97-3, is used for identification in chemical databases and regulatory contexts. Overall, cis-10-heptadecenoic acid is significant in both industrial applications and biological systems.
Formula:C17H32O2
InChI:InChI=1S/C17H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h7-8H,2-6,9-16H2,1H3,(H,18,19)/b8-7-
InChI key:InChIKey=GDTXICBNEOEPAZ-FPLPWBNLSA-N
SMILES:C(CCC/C=C\CCCCCC)CCCCC(O)=O
Synonyms:- (10Z)-10-Heptadecenoic acid
- (10Z)-heptadec-10-enoic acid
- 10-Heptadecenoic acid, (10Z)-
- 10-Heptadecenoic acid, (Z)-
- 10-cis-Heptadecenoic acid
- 10Z-Heptadecenoic acid
- Z 10-Heptadecenoic acid
- cis-10-Heptadecenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
10-Heptadecenoic acid, (10Z)-
CAS:Formula:C17H32O2Purity:98%Color and Shape:LiquidMolecular weight:268.4348cis-10-Heptadecenoic acid
CAS:cis-10-Heptadecenoic acid is a minor constituent of ruminant fats.Formula:C17H32O2Purity:99.86%Color and Shape:SolidMolecular weight:268.4310(Z)-Heptadecenoic acid
CAS:Formula:C17H32O2Purity:>99%Color and Shape:LiquidMolecular weight:268.44cis-10-Heptadecenoic acid
CAS:cis-10-Heptadecenoic acid is a fatty acid with physiological effects. It has been shown to have significant interactions with human serum, and antimicrobial agents, such as coumarin derivatives. cis-10-Heptadecenoic acid has also been shown to be an effective treatment for herpes simplex virus (HSV) infections, which may be due to its ability to inhibit the production of proteins involved in the replication process. cis-10-Heptadecenoic acid can be found in ganoderma lucidum, a mushroom known for its healing properties, and is present in foods that are high in unsaturated fats.
Formula:C17H32O2Purity:Min. 95%Molecular weight:268.43 g/mol







