CAS 2975-00-0
:4,6-bis(dimethylamino)-N,N-dimethyl-1,3,5-triazin-2-aminium chloride
Description:
4,6-bis(dimethylamino)-N,N-dimethyl-1,3,5-triazin-2-aminium chloride, commonly referred to as a quaternary ammonium compound, is characterized by its structure, which includes a triazine ring substituted with multiple dimethylamino groups. This compound is typically a white to off-white solid and is soluble in water, making it useful in various applications, particularly in the fields of biochemistry and pharmaceuticals. Its quaternary ammonium nature imparts cationic properties, which can enhance its interaction with negatively charged surfaces, such as cell membranes, making it a candidate for use in antimicrobial formulations and as a surfactant. The presence of multiple dimethylamino groups contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions. Additionally, this compound may exhibit biological activity, which can be leveraged in drug development or as a research tool. Safety data should be consulted for handling and exposure guidelines, as quaternary ammonium compounds can pose health risks in certain concentrations.
Formula:C9H19ClN6
InChI:InChI=1/C9H18N6.ClH/c1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6;/h1-6H3;1H
SMILES:CN(C)c1nc(nc(n1)N(C)C)N(C)C.Cl
Synonyms:- 1,3,5-Triazine-2,4,6-triamine, N,N,N',N',N'',N''-hexamethyl-, monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,3,5-Triazine-2,4,6-triamine, N2,N2,N4,N4,N6,N6-hexamethyl-, hydrochloride (1:1)
CAS:Formula:C9H19ClN6Molecular weight:246.7404Altretamine hydrochloride
CAS:Altretamine hydrochloride is an alkylating antineoplastic agent.Formula:C9H19ClN6Color and Shape:SolidMolecular weight:246.74Altretamine hydrochloride
CAS:Altretamine hydrochloride is a chemotherapy drug that is metabolized by methylating enzymes, which are primarily located in the liver. It inhibits tumor growth by inhibiting the function of DNA polymerase and DNA topoisomerase I, which are enzymes involved in DNA replication and repair. Altretamine also has anti-cancer activity against respiratory tract tumors. It is not active against tumors that have no oxygen requirements (e.g., breast cancer). Altretamine is toxic to cells when it binds to methyl groups because it prevents their use for other cellular processes. The effects of altretamine on the environment are unknown but may be significant given its high toxicity to aquatic organisms.Formula:C9H19ClN6Purity:Min. 95%Molecular weight:246.74 g/mol


