CAS 29752-43-0
:Altenuene
Description:
Altenuene, with the CAS number 29752-43-0, is a chemical compound that belongs to the class of organic compounds known as terpenes. It is characterized by its unique structure, which includes a bicyclic framework. Altenuene is typically derived from natural sources, particularly certain species of plants, and is known for its aromatic properties. The compound exhibits a range of biological activities, which may include antimicrobial and antioxidant effects, making it of interest in both pharmaceutical and cosmetic applications. Its physical properties, such as boiling point and solubility, can vary depending on the specific conditions and purity of the sample. Altenuene's reactivity is influenced by the presence of functional groups within its structure, allowing it to participate in various chemical reactions. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of natural product chemistry and its potential applications in various industries.
Formula:C15H16O6
InChI:InChI=1/C15H16O6/c1-15-6-12(18)10(16)5-9(15)8-3-7(20-2)4-11(17)13(8)14(19)21-15/h3-5,10,12,16-18H,6H2,1-2H3/t10-,12-,15-/s2
InChI key:InChIKey=MMHTXEATDNFMMY-ANRCJWBCNA-N
SMILES:C[C@@]12C(C=3C(C(=O)O1)=C(O)C=C(OC)C3)=C[C@@H](O)[C@H](O)C2
Synonyms:- (2S,3S,4aS)-2,3,7-trihydroxy-9-methoxy-4a-methyl-2,3,4,4a-tetrahydro-6H-benzo[c]chromen-6-one
- 6H-Dibenzo(b,d)pyran-6-one, 2,3,4,4a-tetrahydro-2,3,7-trihydroxy-9-methoxy-4a-methyl-, (2-alpha,3-beta,4a-beta)-(+-)-
- 6H-Dibenzo[b,d]pyran-6-one, 2,3,4,4a-tetrahydro-2,3,7-trihydroxy-9-methoxy-4a-methyl-, (2R,3R,4aR)-rel-
- 6H-Dibenzo[b,d]pyran-6-one, 2,3,4,4a-tetrahydro-2,3,7-trihydroxy-9-methoxy-4a-methyl-, (2α,3β,4aβ)-
- Altenuene
- Brn 4153870
- Ccris 8303
- rel-(2R,3R,4aR)-2,3,4,4a-Tetrahydro-2,3,7-trihydroxy-9-methoxy-4a-methyl-6H-dibenzo[b,d]pyran-6-one
- 5-18-05-00113 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Altenuene
CAS:Altenuene, a mycotoxin from Alternaria fungi, is common in food/feed and fights some bacteria and cancer cells.Formula:C15H16O6Purity:98%Color and Shape:SolidMolecular weight:292.28(±)-Altenuene 10 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C15H16O6Color and Shape:Single SolutionMolecular weight:292.28Altenuene
CAS:Altenuene is a secondary metabolite, which is derived from the fungus *Alternaria* species. It is produced through the fungal biosynthesis pathway, typically as a byproduct of fungal growth on plant materials or in laboratory cultures. The mode of action of Altenuene involves its interaction with various biological pathways within target organisms, potentially inhibiting or disrupting their normal physiological functions. This makes it interesting as a potential biocontrol agent.Formula:C15H16O6Purity:Min. 95%Molecular weight:292.28 g/mol





