CAS 2976-80-9

4-benzyloxycyclohexanol

Description:

4-Benzyloxycyclohexanol is an organic compound characterized by its cyclohexanol structure substituted with a benzyloxy group at the 4-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents, such as ethanol and ether, while being less soluble in water due to its hydrophobic cyclohexane ring and the bulky benzyloxy group. The presence of the hydroxyl (-OH) group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions in various chemical environments. 4-Benzyloxycyclohexanol can participate in various chemical reactions, including oxidation and substitution reactions, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and other fine chemicals. Its structural features also suggest potential applications in materials science and as a building block for more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₃H₁₈O₂

InChI: InChI=1/C13H18O2/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2

SMILES: c1ccc(cc1)COC1CCC(CC1)O

Cyclohexanol, 4-(phenylmethoxy)-

CAS: 2976-80-9

Formula: C₁₃H₁₈O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 206.2808

Ref: IN-DA002ZBO

4-(Benzyloxy)cyclohexan-1-ol

CAS: 2976-80-9

4-(Benzyloxy)cyclohexan-1-ol

Purity: 95%

Molecular weight: 206.28g/mol

Ref: 54-OR1035317

4-(Benzyloxy)cyclohexanol (cis / trans mixture)

Controlled Product

CAS: 2976-80-9

Applications 4-(Benzyloxy)cyclohexanol (cis / trans mixture) (cas# 2976-80-9) is a compound useful in organic synthesis.

Formula: C₁₃H₁₈O₂

Color and Shape: Neat

Molecular weight: 206.28

Ref: TR-B286390

4-(Benzyloxy)cyclohexanol (cis / trans mixture)

CAS: 2976-80-9

4-(Benzyloxy)cyclohexanol is a complex molecule that is synthesized by the alkylation of benzyl alcohol with cyclohexanol. It has been shown to be an efficient catalyst for the preparation of other molecules, such as methyl benzoate and ethyl benzoate. The use of this catalyst makes it possible to produce these compounds in large quantities at lower cost. 4-(Benzyloxy)cyclohexanol also has a hydroxyl group on its ring structure, which can be used to form esters and ethers that are used in the synthesis of complex molecules. This compound has been studied extensively due to its ability to act as an active site in biomolecules such as proteins and DNA.

Formula: C₁₃H₁₈O₂

Purity: Min. 95%

Color and Shape: Clear Viscous Liquid

Molecular weight: 206.28 g/mol

Ref: 3D-FB18426

4-(Benzyloxy)cyclohexan-1-ol

CAS: 2976-80-9

Purity: 95%

Molecular weight: 206.2850037

Ref: 10-F761295