CymitQuimica logo

CAS 29768-15-8

:

Benzenepropanamine, N-methyl-γ-phenyl-, hydrochloride (1:1)

Description:
Benzenepropanamine, N-methyl-γ-phenyl-, hydrochloride (1:1), with the CAS number 29768-15-8, is a chemical compound that belongs to the class of substituted amines. It features a benzene ring attached to a propanamine chain, with a methyl group on the nitrogen atom, contributing to its unique properties. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it more stable for various applications. The presence of the phenyl group can influence its biological activity and interaction with receptors. As a tertiary amine, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Its potential applications may span across pharmaceuticals, where it could serve as an intermediate in the synthesis of more complex molecules or as a pharmacologically active agent. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C16H19N·ClH
InChI:InChI=1S/C16H19N.ClH/c1-17-13-12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;/h2-11,16-17H,12-13H2,1H3;1H
InChI key:InChIKey=ZRSBFNZFGANOFG-UHFFFAOYSA-N
SMILES:C(CCNC)(C1=CC=CC=C1)C2=CC=CC=C2.Cl
Synonyms:
  • Benzenepropanamine, N-methyl-γ-phenyl-, hydrochloride
  • Propylamine, N-methyl-3,3-diphenyl-, hydrochloride
  • Benzenepropanamine, N-methyl-γ-phenyl-, hydrochloride (1:1)
Found 3 products.