CAS 29769-49-1

N-(6-formyl-4-oxo-1,4-dihydropteridin-2-yl)acetamide

Description:

N-(6-formyl-4-oxo-1,4-dihydropteridin-2-yl)acetamide, with the CAS number 29769-49-1, is a chemical compound that belongs to the class of pteridine derivatives. This substance features a pteridin core structure, which is characterized by a bicyclic arrangement containing nitrogen atoms. The presence of a formyl group and an acetamide moiety contributes to its reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as antimicrobial, antitumor, or enzyme-inhibitory activities, making them of interest in medicinal chemistry. The compound is likely to be soluble in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(6-formyl-4-oxo-1,4-dihydropteridin-2-yl)acetamide represents a unique structure that may have applications in pharmaceutical research and development.

Formula: C₉H₇N₅O₃

InChI: InChI=1/C9H7N5O3/c1-4(16)11-9-13-7-6(8(17)14-9)12-5(3-15)2-10-7/h2-3H,1H3,(H2,10,11,13,14,16,17)

SMILES: CC(=Nc1nc2c(c(n1)O)nc(cn2)C=O)O

N-(6-Formyl-4-oxo-1,4-dihydropteridin-2-yl)acetamide

CAS: 29769-49-1

Formula: C₉H₇N₅O₃

Color and Shape: Solid

Molecular weight: 233.1836

Ref: IN-DA00C30K

2-Acetamido-6-formylpteridin-4-one

CAS: 29769-49-1

2-Acetamido-6-formylpteridin-4-one is a reductive amination product of folic acid. It is a stable compound and has been shown to be useful in the treatment of human diseases such as cancer, Alzheimer's disease, and Parkinson's disease. The reductive amination reaction produces formyl groups that can be acetylated or alkylated to produce stable compounds with different properties. This compound also reacts with glutamic acid to produce an amide.

Formula: C₉H₇N₅O₃

Purity: Min. 97 Area-%

Color and Shape: Powder

Molecular weight: 233.18 g/mol

Ref: 3D-FA16935