CAS 297757-11-0

5-Bromo-6-chloro-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one

Description:

5-Bromo-6-chloro-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyrrole and pyridine moieties. This compound features bromine and chlorine substituents, which can influence its reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of halogens often enhances the compound's potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the unique structural features of this compound may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its CAS number, 297757-11-0, allows for precise identification in chemical databases and literature. As with many heterocycles, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample.

Formula: C₇H₄BrClN₂O

InChI: InChI=1S/C7H4BrClN2O/c8-4-1-3-2-5(12)10-7(3)11-6(4)9/h1H,2H2,(H,10,11,12)

SMILES: c1c2CC(=Nc2nc(c1Br)Cl)O

Synonyms:

• 2H-Pyrrolo[2,3-b]pyridin-2-one, 5-broMo-6-chloro-1,3-dihydro-

2H-Pyrrolo[2,3-b]pyridin-2-one, 5-broMo-6-chloro-1,3-dihydro-

CAS: 297757-11-0

Formula: C₇H₄BrClN₂O

Purity: 95%

Molecular weight: 247.4765

Ref: IN-DA00BW9T

5-Bromo-6-chloro-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one

CAS: 297757-11-0

5-Bromo-6-chloro-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one

Purity: ≥95%

Molecular weight: 247.48g/mol

Ref: 54-OR305538

5-Bromo-6-chloro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one

CAS: 297757-11-0

Formula: C₇H₄BrClN₂O

Purity: 95%

Molecular weight: 247.48

Ref: 10-F497869