CAS 29781-31-5
:(6R,8R,8aR)-2,2-dimethyl-6-(4-nitrophenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol
Description:
The chemical substance with the name "(6R,8R,8aR)-2,2-dimethyl-6-(4-nitrophenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol" and CAS number 29781-31-5 is a complex organic compound characterized by its unique bicyclic structure, which includes a pyran and dioxine moiety. This compound features multiple stereocenters, contributing to its specific three-dimensional configuration, which is crucial for its biological activity. The presence of a nitrophenoxy group indicates potential reactivity and interactions with biological systems, possibly influencing its pharmacological properties. Additionally, the presence of hydroxyl groups (diol) suggests that the compound may exhibit hydrogen bonding capabilities, affecting its solubility and interaction with other molecules. Such structural characteristics often correlate with specific functions in biological systems, making this compound of interest in medicinal chemistry and pharmacology. Its synthesis and applications may be explored in various fields, including drug development and materials science, depending on its reactivity and biological activity.
Formula:C15H19NO8
InChI:InChI=1/C15H19NO8/c1-15(2)21-7-10-13(24-15)11(17)12(18)14(23-10)22-9-5-3-8(4-6-9)16(19)20/h3-6,10-14,17-18H,7H2,1-2H3/t10?,11-,12?,13+,14+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Nitrophenyl 4,6-O-isopropylidene-a-D-galactopyranoside
CAS:4-Nitrophenyl 4,6-O-isopropylidene-a-D-galactopyranoside is a fluorogenic substrate that can be used to measure the activity of beta-galactosidase. This product is high purity, high quality and has a CAS number of 29781-31-5. It is an enzyme substrate with chromogenic and diagnostic properties that are used for conjugation to other molecules, as well as for culture media, chemiluminescence and food testing. 4NP4IPG is also used in bioluminescence assays to detect the presence of beta-galactosidase.
Purity:Min. 95%Molecular weight:341.31 g/mol

