CAS 29799-07-3
:4-(1-adamantyl)phenol
Description:
4-(1-Adamantyl)phenol, with the CAS number 29799-07-3, is an organic compound characterized by the presence of an adamantyl group attached to a phenolic structure. This compound features a bulky adamantyl moiety, which contributes to its unique physical and chemical properties, including increased hydrophobicity and potential steric hindrance. It typically appears as a white to off-white solid and is soluble in organic solvents while exhibiting limited solubility in water. The phenolic hydroxyl group imparts acidity, allowing it to participate in hydrogen bonding and potentially act as an antioxidant or a stabilizer in various chemical reactions. Additionally, 4-(1-adamantyl)phenol may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its structural characteristics can influence its reactivity, making it suitable for applications in polymer chemistry and as a precursor in the synthesis of more complex organic molecules. Overall, this compound's unique structure and properties make it a subject of interest in various fields of research.
Formula:C16H20O
InChI:InChI=1/C16H20O/c17-15-3-1-14(2-4-15)16-8-11-5-12(9-16)7-13(6-11)10-16/h1-4,11-13,17H,5-10H2
SMILES:c1cc(ccc1C12CC3CC(CC(C3)C2)C1)O
Synonyms:- Adamantylphenol
- 4-(Tricyclo[3.3.1.1~3,7~]Dec-1-Yl)Phenol
- P-(1-ADAMANTYL)PHENOL
- 4-(Adamantan-1-yl)phenol
- IFLAB-BB F0701-0062
- 4-(1-ADAMANTYL)PHENOL
- SALOR-INT L496022-1EA
- 1-(4-HYDROXYPHENYL)ADAMANTANE
- LABOTEST-BB LT00007821
- AKOS BC-0514
- 4-(1-AAMANTYL)-PHENOL
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-(1-Adamantyl)phenol
CAS:Formula:C16H20OPurity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:228.34Phenol, 4-tricyclo[3.3.1.13,7]dec-1-yl-
CAS:Formula:C16H20OPurity:97%Color and Shape:SolidMolecular weight:228.32944-(1-Adamantyl) phenol
CAS:4-(1-Adamantyl) phenol is a natural compound that is found in the essential oil of nutmeg and mace. 4-(1-Adamantyl) phenol binds to the receptor for 1-adamantanol, which is a neurotransmitter in animals and humans. This binding inhibits the response pathway of this neurotransmitter, which can lead to an inhibitory effect on pain transmission. The structure of 4-(1-Adamantyl) phenol has been determined by X-ray crystallography and molecular docking analysis. It also has been shown that this compound reacts with trifluoroacetic acid under Friedel-Crafts conditions to form 3-(2'-hydroxyethyl)-4-(1'-adamantyl)-phenol. These compounds have been shown to have an inhibitory effect on animal health.Formula:C16H20OPurity:Min. 95%Color and Shape:PowderMolecular weight:228.33 g/mol4-(1-Adamantyl)phenol
CAS:Controlled Product<p>Applications 4-(1-Adamantyl)phenol is used to study inhibitors of oral bacteria.<br>References Baures, P., et al.: Bioorg. Med. Chem., 6, 1389 (1998); Shapiro, S., et al.: Quant. Structure-Activity Rel., 17, 327 (1998)<br></p>Formula:C16H20OColor and Shape:NeatMolecular weight:228.33






