CAS 29799-22-2
:Diapocynin
Description:
Diapocynin, with the CAS number 29799-22-2, is a chemical compound that belongs to the class of phenolic compounds. It is recognized for its potential biological activities, particularly in the context of antioxidant properties and its role in cellular signaling pathways. Diapocynin is often studied for its effects on nitric oxide production and its implications in various physiological processes. The compound is typically characterized by its ability to modulate oxidative stress and inflammation, making it of interest in pharmacological research. Its structure features a phenolic moiety, which contributes to its reactivity and interaction with biological systems. Diapocynin is soluble in organic solvents and may exhibit varying solubility in water, depending on the conditions. As with many chemical substances, safety and handling precautions are essential, as it may pose risks if not managed properly. Overall, Diapocynin represents a significant area of study in medicinal chemistry and biochemistry due to its potential therapeutic applications.
Formula:C18H18O6
InChI:InChI=1S/C18H18O6/c1-9(19)11-5-13(17(21)15(7-11)23-3)14-6-12(10(2)20)8-16(24-4)18(14)22/h5-8,21-22H,1-4H3
InChI key:InChIKey=HLNDPICGHQGWSU-UHFFFAOYSA-N
SMILES:OC1=C(C=C(C(C)=O)C=C1OC)C2=C(O)C(OC)=CC(C(C)=O)=C2
Synonyms:- Ethanone, 1,1′-(6,6′-dihydroxy-5,5′-dimethoxy[1,1′-biphenyl]-3,3′-diyl)bis-
- 1,1′-(6,6′-Dihydroxy-5,5′-dimethoxy[1,1′-biphenyl]-3,3′-diyl)bis[ethanone]
- Diapocynin
- Dehydrodiacetovanillone
- 3′,3′′′-Biacetophenone, 4′,4′′′-dihydroxy-5′,5′′′-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Diapocynin
CAS:Diapocynin (Dehydrodiacetovanillone), a dimer of Apocynin, acts as an orally administered inhibitor of NADPH oxidase.Formula:C18H18O6Color and Shape:SolidMolecular weight:330.33
