CymitQuimica logo

CAS 29802-22-0

:

H-Pro-NMe2

Description:
The chemical substance known as H-Pro-NMe2, with the CAS number 29802-22-0, is a derivative of proline, an amino acid commonly found in proteins. This compound features a proline backbone with a dimethylamino group attached, which influences its chemical properties and biological activity. H-Pro-NMe2 is characterized by its ability to participate in hydrogen bonding due to the presence of the amino group, making it soluble in polar solvents. Its structure allows it to adopt specific conformations, which can be crucial for its interactions in biological systems. The dimethylamino group contributes to its basicity, potentially affecting its reactivity and interaction with other molecules. This compound may be of interest in various fields, including medicinal chemistry and biochemistry, due to its potential role in peptide synthesis and as a building block for more complex molecules. Overall, H-Pro-NMe2 exemplifies the diverse functionalities that can arise from modifications to amino acid structures.
Formula:C7H14N2O
InChI:InChI=1/C7H14N2O/c1-9(2)7(10)6-4-3-5-8-6/h6,8H,3-5H2,1-2H3/t6-/m0/s1
InChI key:MLLMAIJXIZOSFS-LURJTMIESA-N
SMILES:CN(C)C(=O)[C@@H]1CCCN1
Synonyms:
  • L-Proline-N,N-Dimethylamide
  • N,N-dimethylprolinamide
  • N,N-dimethyl-L-prolinamide
Found 6 products.