CAS 29812-97-3

Cyclopropanamine, 1-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:

Cyclopropanamine, 1-[(3-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and an amine functional group. The presence of a 3-chlorophenylmethyl substituent indicates that a chlorinated phenyl group is attached to the cyclopropanamine, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity due to its amine functionality, which can interact with biological receptors. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Safety and handling precautions are essential, as with many amines and their derivatives, due to potential toxicity and reactivity. Overall, this compound represents a specific class of organic molecules with distinct structural and functional characteristics relevant to chemical and pharmaceutical research.

Formula: C₁₀H₁₂ClN·ClH

InChI: InChI=1S/C10H12ClN.ClH/c11-9-3-1-2-8(6-9)7-10(12)4-5-10;/h1-3,6H,4-5,7,12H2;1H

InChI key: InChIKey=DOPDQDZLLOAXKU-UHFFFAOYSA-N

SMILES: C(C1(N)CC1)C2=CC(Cl)=CC=C2.Cl

Synonyms:

• Cyclopropylamine, 1-(m-chlorobenzyl)-, hydrochloride
• 1-[(3-Chlorophenyl)methyl]cyclopropan-1-amine hydrochloride
• Cyclopropanamine, 1-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)

1-[(3-Chlorophenyl)methyl]cyclopropan-1-amine hydrochloride

CAS: 29812-97-3

Versatile small molecule scaffold

Formula: C₁₀H₁₃Cl₂N

Purity: Min. 95%

Molecular weight: 218.12 g/mol

Ref: 3D-EBA81297