CAS 29836-01-9

8-(methylsulfanyl)-9-pentofuranosyl-9H-purin-6-amine

Description:

8-(Methylsulfanyl)-9-pentofuranosyl-9H-purin-6-amine, with the CAS number 29836-01-9, is a purine derivative characterized by the presence of a methylsulfanyl group at the 8-position and a pentofuranosyl moiety at the 9-position of the purine ring. This compound exhibits properties typical of nucleobases, including potential interactions with nucleic acids and involvement in biochemical pathways. Its structure suggests it may participate in various biological processes, possibly acting as a nucleoside analog. The methylsulfanyl group can influence its solubility and reactivity, while the furanosyl sugar component is crucial for its biological activity, as it mimics the structure of naturally occurring nucleosides. This compound may be of interest in medicinal chemistry and biochemistry for its potential applications in drug development or as a research tool in studying nucleic acid interactions. Further studies would be necessary to elucidate its specific biological activities and potential therapeutic uses.

Formula: C₁₁H₁₅N₅O₄S

InChI: InChI=1/C11H15N5O4S/c1-21-11-15-5-8(12)13-3-14-9(5)16(11)10-7(19)6(18)4(2-17)20-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,13,14)

SMILES: CSc1nc2c(N)ncnc2n1C1C(C(C(CO)O1)O)O

8-Methylthio-adenosine

CAS: 29836-01-9

8-Methylthio-adenosine is a Nucleoside Derivative - 8-Modified purine nucleoside.

Formula: C₁₁H₁₅N₅O₄S

Color and Shape: Solid

Molecular weight: 313.33

Ref: TM-TNU0398

8-Methylthioadenosine

CAS: 29836-01-9

8-Methylthioadenosine is a synthetic analogue of adenosine that has been used as a biochemical stimulator. It has been shown to inhibit uptake of fatty acids and phospholipids into cells, which may be due to the inhibition of cellular ATPase. 8-Methylthioadenosine can also be used as a precursor for other molecules, such as methylation of DNA or RNA. 8-Methylthioadenosine is synthesized from linolenic acid and phosphate in a reaction catalyzed by molecular oxygen. The synthesis is stimulated by light and heat and inhibited by cyanide. Magnetic resonance spectroscopy (NMR) was used to confirm that the molecule had the correct structure.

Purity: Min. 95%

Ref: 3D-NM163121