CAS 29837-07-8
:cis-α-Bisabolene
Description:
Cis-α-Bisabolene is a naturally occurring sesquiterpene hydrocarbon characterized by its unique structure and properties. It is primarily found in essential oils of various plants, contributing to their aroma and flavor profiles. The compound is known for its characteristic sweet, floral scent, making it valuable in the fragrance and flavor industry. Chemically, cis-α-Bisabolene has a molecular formula that reflects its sesquiterpene classification, typically consisting of 15 carbon atoms and 24 hydrogen atoms. It exhibits a relatively low boiling point, which is common among volatile organic compounds, and is insoluble in water but soluble in organic solvents. The compound can undergo various chemical reactions, including oxidation and polymerization, which can alter its properties and applications. Additionally, cis-α-Bisabolene has been studied for its potential biological activities, including antimicrobial and anti-inflammatory effects, although further research is needed to fully understand its therapeutic potential. Overall, cis-α-Bisabolene is an important compound in both natural product chemistry and industrial applications.
Formula:C15H24
InChI:InChI=1/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6-8,15H,5,9-11H2,1-4H3/b14-7-
InChI key:InChIKey=YHBUQBJHSRGZNF-AUWJEWJLNA-N
SMILES:C(=C/CC=C(C)C)(\C)/C1CCC(C)=CC1
Synonyms:- Cyclohexene, 4-(1,5-dimethyl-1,4-hexadienyl)-1-methyl-, (Z)-
- Cyclohexene, 4-[(1Z)-1,5-dimethyl-1,4-hexadien-1-yl]-1-methyl-
- 4-[(1Z)-1,5-Dimethyl-1,4-hexadien-1-yl]-1-methylcyclohexene
- 2,5-Heptadiene, 2-methyl-6-(4-methyl-3-cyclohexen-1-yl)-, (Z)-
- Cyclohexene, 4-[(1Z)-1,5-dimethyl-1,4-hexadienyl]-1-methyl-
- (Z)-a-Bisabolene
- (Z)-alpha-bisabolene
- 29837-07-8 Cyclohexene, 4-(1,5-dimethyl-1,4-hexadienyl)-1-methyl-, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
