CymitQuimica logo

CAS 29844-80-2

:

1-(Octahydro-2,5-methanopentalen-1-yl)ethanone

Description:
1-(Octahydro-2,5-methanopentalen-1-yl)ethanone, with the CAS number 29844-80-2, is a chemical compound characterized by its unique bicyclic structure, which includes a saturated hydrocarbon framework. This compound features a ketone functional group, indicated by the "ethanone" part of its name, suggesting the presence of a carbonyl group (C=O) adjacent to an ethyl group. The octahydro-2,5-methanopentalen moiety contributes to its complex cyclic structure, which can influence its physical and chemical properties, such as boiling point, melting point, and solubility. Typically, compounds of this nature may exhibit moderate polarity due to the ketone group, affecting their reactivity and interactions with other substances. Additionally, the presence of multiple rings can impart stability and rigidity to the molecule, which may be relevant in various applications, including pharmaceuticals or as intermediates in organic synthesis. However, specific characteristics such as exact melting and boiling points, solubility, and reactivity would require empirical data for precise determination.
Formula:C11H16O
InChI:InChI=1S/C11H16O/c1-6(12)11-9-3-7-2-8(5-9)10(11)4-7/h7-11H,2-5H2,1H3
SMILES:CC(=O)C1C2CC3CC(C2)C1C3
Synonyms:
  • 1-(Tricyclo[3.3.1.03,7]non-2-yl)ethanone
  • Ethanone, 1-(Octahydro-2,5-Methanopentalen-1-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.