CAS 29847-23-2
:2-acetamido-1-azido-1-2-dideoxy-B-D-*glucopyranos
Description:
2-Acetamido-1-azido-1,2-dideoxy-β-D-glucopyranos, with the CAS number 29847-23-2, is a carbohydrate derivative characterized by the presence of an acetamido group and an azido group on a dideoxy sugar structure. This compound is a modified form of glucopyranose, which is a six-membered cyclic form of glucose. The azido group (-N3) is notable for its reactivity, often utilized in click chemistry and bioconjugation applications. The acetamido group (-NHCOCH3) contributes to the compound's solubility and stability, making it suitable for various biochemical applications. The dideoxy nature indicates that two hydroxyl groups have been replaced by hydrogen atoms, which can influence the compound's biological activity and interaction with enzymes. Overall, this compound is of interest in synthetic organic chemistry and may have potential applications in drug development and glycoscience research. Its unique functional groups allow for further modifications and the exploration of its properties in various chemical contexts.
Formula:C8H14N4O5
InChI:InChI=1/C8H14N4O5/c1-3(14)10-5-7(16)6(15)4(2-13)17-8(5)11-12-9/h4-8,13,15-16H,2H2,1H3,(H,10,14)/t4-,5-,6-,7-,8-/m1/s1
SMILES:CC(=N[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@H]1N=[N+]=[NH-])O)O)O
Synonyms:- N-[(2R,3R,4R,5S,6R)-2-azido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide
- 2-Acetamido-2-Deoxy-Beta-D-Glucopyranosyl Azide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Acetamido-2-deoxy-β-D-glucopyranosyl azide
CAS:Formula:C8H14N4O5Purity:95%Color and Shape:SolidMolecular weight:246.22062-Acetamido-2-deoxy-β-D-glucopyranosyl azide
CAS:2-Acetamido-2-deoxy-β-D-glucopyranosyl azideMolecular weight:246.22g/mol2-Acetamido-2-deoxy-β-D-glucopyranosyl Azide
CAS:Controlled ProductFormula:C8H14N4O5Color and Shape:NeatMolecular weight:246.222-Acetamido-2-deoxy-b-D-glucopyranosyl azide
CAS:2-Acetamido-2-deoxy-b-D-glucopyranosyl azide is a biodegradable, environmentally oriented compound that has been shown to be compatible with polylactic acid. This compound has shown unevenness in the hydroxy group and a functional group sensitive to hydrolysis. The molecular weight of 2-acetamido-2-deoxy-b-D-glucopyranosyl azide is 154.14 g/mol. It is soluble in water and has a natural environment frequency of 0.0005%.
Formula:C8H14N4O5Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:246.22 g/mol





