CAS 29848-59-7

1-Bromo-3-(difluoromethyl)benzene

Description:

1-Bromo-3-(difluoromethyl)benzene, with the CAS number 29848-59-7, is an aromatic compound characterized by the presence of a bromine atom and a difluoromethyl group attached to a benzene ring. This compound features a bromine substituent at the meta position relative to the difluoromethyl group, which consists of two fluorine atoms bonded to a carbon atom. The presence of both bromine and fluorine introduces significant electronegativity and polarity, influencing the compound's reactivity and physical properties. Typically, such compounds exhibit moderate to high boiling points due to the presence of halogen atoms, which can also enhance their solubility in organic solvents. The difluoromethyl group can impart unique chemical behavior, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. Additionally, the compound's structure may allow for specific interactions in biological systems, making it of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks.

Formula: C₇H₅BrF₂

InChI: InChI=1/C7H5BrF2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,7H

SMILES: c1cc(cc(c1)Br)C(F)F

Synonyms:

• Benzene, 1-bromo-3-(difluoromethyl)-

1-Bromo-3-(difluoromethyl)benzene

CAS: 29848-59-7

Formula: C₇H₅BrF₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 207.0154

Ref: IN-DA0037EZ

3-Bromobenzal fluoride

CAS: 29848-59-7

3-Bromobenzal fluoride

Formula: C₇H₅BrF₂

Purity: 98%

Color and Shape: clear. colourless liquid

Molecular weight: 207.02g/mol

Ref: 54-PC50007

1-Bromo-3-(difluoromethyl)benzene

CAS: 29848-59-7

Formula: C₇H₅BrF₂

Purity: 95%

Color and Shape: Liquid, Clear

Molecular weight: 207.018

Ref: 10-F024453