CAS 2985-33-3
:3-ethoxy-2-methyl-3-oxopropanoic acid
Description:
3-Ethoxy-2-methyl-3-oxopropanoic acid is an organic compound characterized by its functional groups, which include an ethoxy group, a ketone, and a carboxylic acid. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It has a relatively low molecular weight and is soluble in polar solvents due to the presence of the carboxylic acid group. The ethoxy group contributes to its hydrophobic characteristics, while the carboxylic acid imparts acidic properties. This compound is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the ketone and carboxylic acid functionalities, allowing for various chemical transformations. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled. Overall, 3-ethoxy-2-methyl-3-oxopropanoic acid is a versatile compound with applications in chemical synthesis and research.
Formula:C6H10O4
InChI:InChI=1/C6H10O4/c1-3-10-6(9)4(2)5(7)8/h4H,3H2,1-2H3,(H,7,8)
SMILES:CCOC(=O)C(C)C(=O)O
Synonyms:- 2-Methylmalonic acid monoethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Ethoxy-2-methyl-3-oxopropanoic acid
CAS:Formula:C6H10O4Purity:98%Color and Shape:LiquidMolecular weight:146.14123-Ethoxy-2-Methyl-3-Oxopropanoic Acid
CAS:3-Ethoxy-2-Methyl-3-Oxopropanoic AcidPurity:97%Molecular weight:146.14g/molEthyl 2-Carboxypropionate (>85%)
CAS:Controlled ProductFormula:C6H10O4Purity:>85%Color and Shape:NeatMolecular weight:146.143-Ethoxy-2-methyl-3-oxopropanoic acid
CAS:Formula:C6H10O4Purity:97%Color and Shape:LiquidMolecular weight:146.142Ethyl 2-Carboxypropionate-D3
CAS:Controlled ProductApplications Ethyl 2-Carboxypropionate-D3 is an intermediate in the synthesis of 2-Methylcitric Acid-d3 (M265082), which is the isotope labelled analog of 2-Methylcitric Acid (M265080); a metabolite of Citric Acid (C521000) that can be formed from the condensation of propionoyl-CoA and oxaloacetic acid catalyzed by a citrate synthase enzyme.
References Allen, R. H., et al.: Metabolism, 42, 978 (1993)Formula:C6D3H7O4Color and Shape:NeatMolecular weight:149.16



