CAS 2986-25-6
:N-Nitro-S-methyl isothiourea
Description:
N-Nitro-S-methyl isothiourea is a chemical compound characterized by its isothiourea functional group, which features a sulfur atom bonded to a nitrogen atom and a carbon atom. This compound typically appears as a solid and is known for its role in various chemical reactions, particularly in the synthesis of other nitrogen-containing compounds. It is often utilized in biochemical research due to its ability to act as a substrate or inhibitor in enzymatic reactions. The presence of the nitro group enhances its reactivity, making it a useful intermediate in organic synthesis. N-Nitro-S-methyl isothiourea is also noted for its potential biological activity, which may include effects on cellular processes. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures in laboratory settings. As with many chemical substances, proper storage and disposal protocols are essential to mitigate any environmental or health risks associated with its use.
Formula:C2H5N3O2S
InChI:InChI=1/C2H5N3O2S/c1-8-2(3)4-5(6)7/h1H3,(H2,3,4)
SMILES:CSC(=N)NN(=O)=O
Synonyms:- carbamimidothioic acid, N'-nitro-, methyl ester
- Methyl N'-nitrocarbamimidothioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl nitrocarbamimidothioate
CAS:Methyl nitrocarbamimidothioatePurity:95%Molecular weight:135.15g/molN-Nitro-S-methylisothiourea
CAS:Controlled ProductApplications N-Nitro-S-methylisothiourea is used as a reactant in the preparation of 1,5-substituted-1,3,5-hexahydrotriazine-2-N-nitroimines with insecticidal activity.
References Xue, S., et. al.: J Heterocyciic Chem., 50, 1067 (2013)Formula:C2H5N3O2SColor and Shape:NeatMolecular weight:135.14N-Nitro-S-methylisothiourea-13C
CAS:Controlled ProductApplications N-Nitro-S-methylisothiourea-13C is an intermediate used in the synthesis of Clothianidin-d3, 13C1 (C588502), which is the isotope labelled analog of Clothianidin. Clothianidin is a neonicotinoid insecticide for use in food crops.
References Kamel, A., et al.: J. Agric. Food Chem., 58, 5926 (2010), Lynd, L., et al.: Energy Environ. Sci., 3, 1150 (2010), Cresswell, J., et al.: Ecotoxicology, 20, 149 (2011),Formula:CCH5N3O2SColor and Shape:NeatMolecular weight:136.138



