CAS 298686-55-2

3-{[(2-methylfuran-3-yl)carbonyl]amino}benzoic acid

Description:

3-{[(2-Methylfuran-3-yl)carbonyl]amino}benzoic acid, with the CAS number 298686-55-2, is an organic compound characterized by its complex structure that includes both an amino group and a carboxylic acid functional group. This compound features a benzoic acid moiety, which contributes to its acidity and potential for forming hydrogen bonds. The presence of the 2-methylfuran group introduces a heterocyclic element, enhancing its chemical reactivity and possibly influencing its solubility and stability. The carbonyl group linked to the amino group suggests that it may participate in various chemical reactions, such as acylation or amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, solubility, and reactivity, would depend on the specific interactions between its functional groups and the surrounding environment. Overall, this compound represents a unique combination of aromatic and heterocyclic chemistry, with potential applications in medicinal chemistry and material science.

Formula: C₁₃H₁₁NO₄

InChI: InChI=1/C13H11NO4/c1-8-11(5-6-18-8)12(15)14-10-4-2-3-9(7-10)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17)

SMILES: Cc1c(cco1)C(=Nc1cccc(c1)C(=O)O)O

3-[(2-methyl-3-furoyl)amino]benzoic acid

CAS: 298686-55-2

Formula: C₁₃H₁₁NO₄

Purity: 95.0%

Molecular weight: 245.234

Ref: 10-F315306