CAS 2987-49-7
:2-(Methylsulfonyl)benzenamine
Description:
2-(Methylsulfonyl)benzenamine, also known as a sulfonamide derivative, is an organic compound characterized by the presence of both an amine group and a methylsulfonyl functional group attached to a benzene ring. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents due to the presence of the sulfonyl group, which enhances its polarity. The methylsulfonyl group contributes to its potential as a nucleophile in various chemical reactions, making it useful in synthetic organic chemistry. Additionally, the amine group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The compound may also exhibit biological activity, as many sulfonamide derivatives are known for their pharmaceutical properties. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact. Overall, 2-(Methylsulfonyl)benzenamine is a versatile compound with applications in both research and industry.
Formula:C7H9NO2S
InChI:InChI=1S/C7H9NO2S/c1-11(9,10)7-5-3-2-4-6(7)8/h2-5H,8H2,1H3
InChI key:InChIKey=AUSRSVRJOXYXMI-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(N)C=CC=C1
Synonyms:- 2-(Methanesulfonyl)aniline
- 2-(Methylsulfonyl)aniline
- 2-(Methylsulfonyl)benzenamine
- 2-Aminophenyl methyl sulfone
- Aniline, o-(methylsulfonyl)-
- Aniline,o-(methylsulfonyl)- (6CI,7CI,8CI)
- Claasz's sulfurylindoxyl
- Claasz'ssulfurylindoxyl
- Nsc 55747
- o-(Methylsulfonyl)aniline
- Benzenamine, 2-(methylsulfonyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Methylsulfonyl)aniline
CAS:Formula:C7H9NO2SPurity:98%Color and Shape:SolidMolecular weight:171.2169Ref: IN-DA00BJ39
50gTo inquire100gTo inquire100mg23.00€250mg36.00€1g61.00€5g163.00€10g234.00€25g357.00€2-(Methylsulphonyl)aniline
CAS:2-(Methylsulphonyl)anilineFormula:C7H9NO2SPurity:99%Color and Shape: off-white/faint cream crystalline powderMolecular weight:171.22g/mol2-(Methylsulfonyl)aniline
CAS:2-(Methylsulfonyl)aniline is a synthetic chemical that inhibits the activity of the viral NS5B polymerase. It has been shown to have a constant, research-based kinetic for its inhibitory effects on this enzyme. Inhibition occurs through the scission of the N-O bond in 2-(methylsulfonyl)aniline to form 2-aminopurine and methyl sulfate. This reaction also produces a hydroxide solution, which is responsible for the detoxification of 2-(methylsulfonyl)aniline by sodium hydroxide solution. The inhibition of NS5B polymerase leads to an inhibition of RNA synthesis and protein expression. This chemical is not active against bacterial cells, and therefore it can be used as a selective inhibitor for experimental purposes.Formula:C7H9NO2SPurity:Min. 95%Color and Shape:White PowderMolecular weight:171.22 g/mol




