CAS 29870-28-8: Dimethylaminoethanolhydrogentartrate

Description:Dimethylaminoethanol hydrogentartrate, with the CAS number 29870-28-8, is a chemical compound that features a dimethylamino group attached to an ethanol backbone, combined with a hydrogentartrate moiety. This substance is typically characterized by its role as a chiral auxiliary in asymmetric synthesis, often utilized in organic chemistry to facilitate the production of enantiomerically pure compounds. It is a colorless to pale yellow liquid or solid, depending on its form, and is soluble in water and various organic solvents. The presence of the dimethylamino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the hydrogentartrate component can influence the compound's solubility and reactivity. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, dimethylaminoethanol hydrogentartrate is valued in synthetic chemistry for its utility in enhancing reaction selectivity and efficiency.

Formula:C₈H₁₇NO₇

InChI:InChI=1S/C4H11NO.C4H6O6/c1-5(2)3-4-6;5-1(3(7)8)2(6)4(9)10/h6H,3-4H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1

InChI key:InChIKey=UIEGYKVRCKDVKQ-LREBCSMRSA-N

SMILES:O=C(O)C(O)C(O)C(=O)O.OCCN(C)C