CAS 298705-59-6

1-(2-bromobenzyl)piperazine

Description:

1-(2-Bromobenzyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a bromobenzyl group at the 1-position of the piperazine ring contributes to its unique properties. This compound typically appears as a white to off-white solid and is soluble in organic solvents. It has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The bromine atom in the structure can influence the compound's reactivity and biological activity, making it a subject of interest in research. Additionally, the compound's molecular structure allows for various modifications, which can lead to derivatives with enhanced or altered properties. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, 1-(2-bromobenzyl)piperazine serves as a valuable compound in both synthetic and medicinal chemistry contexts.

Formula: C₁₁H₁₅BrN₂

InChI: InChI=1/C11H15BrN2/c12-11-4-2-1-3-10(11)9-14-7-5-13-6-8-14/h1-4,13H,5-9H2

SMILES: c1ccc(c(c1)CN1CCNCC1)Br

Synonyms:

• 1-(2-Bromo-benzyl)-piperazine
• Piperazine, 1-[(2-bromophenyl)methyl]-
• 1-(2-Bromobenzyl)piperazine
• 1-(2-BroMobenzyl)piperazine 2HCl
• 1-(2-Bromobenzyl)piperazine dihydrochloride
• 1-[(2-Bromophenyl)methyl]piperazine
• 1-(2-bromobenzyl)piperazine(SALTDATA: HCl)

1-(2-bromobenzyl)piperazine

Controlled Product

CAS: 298705-59-6

Versatile small molecule scaffold

Formula: C₁₁H₁₅BrN₂

Purity: Min. 95%

Molecular weight: 255.16 g/mol

Ref: 3D-YLA70559