CAS 29881-14-9
:1,2-Diphenylcyclopropane
Description:
1,2-Diphenylcyclopropane is an organic compound characterized by its unique cyclopropane structure, which consists of a three-membered carbon ring bonded to two phenyl groups. This compound exhibits a relatively high degree of stability due to the presence of the phenyl rings, which provide steric hindrance and electronic effects that stabilize the cyclopropane ring. It is typically a colorless to pale yellow solid at room temperature and is insoluble in water but soluble in organic solvents. The compound is of interest in organic synthesis and materials science due to its potential applications in the development of novel polymers and as a building block in organic chemistry. Its reactivity is influenced by the strain in the cyclopropane ring, which can undergo various reactions such as ring-opening under certain conditions. Additionally, 1,2-diphenylcyclopropane can serve as a model compound for studying the properties and behaviors of more complex cyclic compounds. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C15H14
InChI:InChI=1/C15H14/c1-3-7-12(8-4-1)14-11-15(14)13-9-5-2-6-10-13/h1-10,14-15H,11H2
SMILES:c1ccc(cc1)C1CC1c1ccccc1
Synonyms:- 1,1'-Cyclopropane-1,2-Diyldibenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2-Diphenylcyclopropane, cis + trans, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C15H14Purity:97%Color and Shape:Clear dark yellow to yellow to orange, LiquidMolecular weight:194.28




