CAS 2991-84-6
:Nonafluorobutanesulfonyl chloride
Description:
Nonafluorobutanesulfonyl chloride, with the CAS number 2991-84-6, is a fluorinated sulfonyl chloride that features a perfluorinated butane chain. This compound is characterized by its high stability and low reactivity due to the presence of fluorine atoms, which impart unique properties such as hydrophobicity and lipophobicity. It is typically a colorless to pale yellow liquid at room temperature and has a pungent odor. Nonafluorobutanesulfonyl chloride is primarily used in organic synthesis, particularly in the preparation of sulfonamide derivatives and as a reagent in various chemical reactions. Its strong electrophilic nature makes it effective for introducing sulfonyl groups into organic molecules. Additionally, due to its fluorinated structure, it exhibits low surface tension and high thermal stability, making it suitable for applications in specialty chemicals and materials science. However, handling this compound requires caution due to its corrosive nature and potential environmental impact, necessitating appropriate safety measures during use.
Formula:C4ClF9O2S
InChI:InChI=1/C4ClF9O2S/c5-17(15,16)4(13,14)2(8,9)1(6,7)3(10,11)12
SMILES:C(C(C(F)(F)S(=O)(=O)Cl)(F)F)(C(F)(F)F)(F)F
Synonyms:- 1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-sulfonyl chloride
- 1-Butanesulfonyl Chloride, 1,1,2,2,3,3,4,4,4-Nonafluoro-
- Perfluorobutanesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Nonafluorobutanesulfonyl chloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:CF3(CF2)3SO2ClPurity:98%Color and Shape:Clear colorless, LiquidMolecular weight:318.55Nonafluoro-1-butanesulfonyl chloride
CAS:Formula:C4ClF9O2SPurity:%Color and Shape:LiquidMolecular weight:318.5452Nonafluorobutane-1-sulphonyl chloride
CAS:Nonafluorobutane-1-sulphonyl chlorideFormula:C4ClF9O2SPurity:97%Color and Shape: clear. colourless liquidMolecular weight:318.55g/mol


