CymitQuimica logo

CAS 299168-94-8

:

AMINO(3-PHENOXYPHENYL)ACETIC ACID

Description:
Amino(3-phenoxyphenyl)acetic acid, identified by its CAS number 299168-94-8, is an organic compound characterized by the presence of an amino group, a phenoxy group, and an acetic acid moiety. This compound typically exhibits properties associated with both amino acids and phenolic compounds, making it of interest in various chemical and biological applications. It is likely to be a white to off-white solid, soluble in polar solvents due to the presence of the amino and carboxylic acid functional groups. The phenoxy group contributes to its potential for engaging in hydrogen bonding and π-π interactions, which can influence its reactivity and interactions with biological targets. The compound may also exhibit biological activity, potentially serving as a building block in pharmaceuticals or agrochemicals. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental conditions such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C14H13NO3
InChI:InChI=1S/C14H13NO3/c15-13(14(16)17)10-5-4-8-12(9-10)18-11-6-2-1-3-7-11/h1-9,13H,15H2,(H,16,17)
InChI key:PTDUZBVRDQXJJC-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)OC2=CC=CC(=C2)C(C(=O)O)N
Found 3 products.