CAS 299169-54-3
:4-(2-Methoxyphenyl)-2(3H)-thiazolone hydrazone
Description:
4-(2-Methoxyphenyl)-2(3H)-thiazolone hydrazone is an organic compound characterized by its thiazolone and hydrazone functional groups. This compound typically exhibits a yellow to orange color, which is common for many thiazolone derivatives due to their conjugated systems. It is likely to be soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), while its solubility in water may be limited due to the hydrophobic nature of the methoxyphenyl group. The presence of the hydrazone linkage suggests potential reactivity, particularly in condensation reactions or as a ligand in coordination chemistry. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The thiazolone moiety can also contribute to the compound's stability and reactivity, influencing its interactions in various chemical environments. Overall, 4-(2-Methoxyphenyl)-2(3H)-thiazolone hydrazone represents a versatile structure with potential applications in both synthetic and biological chemistry.
Formula:C10H11N3OS
InChI:InChI=1/C10H11N3OS/c1-14-9-5-3-2-4-7(9)8-6-15-10(12-8)13-11/h2-6H,11H2,1H3,(H,12,13)
SMILES:COc1ccccc1c1csc(n1)NN
Synonyms:- 2(3H)-thiazolone, 4-(2-methoxyphenyl)-, hydrazone
- 2-Hydrazino-4-(2-methoxyphenyl)-1,3-thiazole
- 2-Hydrazono-4-(2-methoxyphenyl)-2,3-dihydro-1,3-thiazole
- Thiazole, 2-hydrazinyl-4-(2-methoxyphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-(2-Methoxyphenyl)-2(3H)-thiazolone hydrazone
CAS:4-(2-Methoxyphenyl)-2(3H)-thiazolone hydrazone is a versatile building block for the synthesis of complex compounds. It is also a useful intermediate for the preparation of research chemicals, reagents, and speciality chemicals. 4-(2-Methoxyphenyl)-2(3H)-thiazolone hydrazone has been used in the synthesis of a number of biologically active compounds, including hydroxyarylacetamides and 2,5-dioxo-4-(2-methoxybenzoyl)thiazolidine derivatives. This compound can be used as a scaffold to produce novel compounds with biological activity.Formula:C10H11N3OSPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:221.28 g/mol


