CAS 299181-34-3

3-[(Diethylamino)sulfonyl]-4-methoxybenzoic acid

Description:

3-[(Diethylamino)sulfonyl]-4-methoxybenzoic acid, identified by its CAS number 299181-34-3, is an organic compound characterized by its sulfonamide functional group, which contributes to its chemical reactivity and solubility properties. This compound features a methoxy group (-OCH3) attached to a benzoic acid structure, enhancing its lipophilicity and potential biological activity. The presence of the diethylamino group provides basicity, which can influence its interaction with biological targets, making it of interest in medicinal chemistry. The sulfonyl group (-SO2-) is known for its ability to form strong hydrogen bonds, which can enhance the compound's solubility in polar solvents. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its stability, solubility, and reactivity are essential characteristics that would be evaluated in further studies to determine its efficacy and safety in various applications.

Formula: C₁₂H₁₇NO₅S

InChI: InChI=1S/C12H17NO5S/c1-4-13(5-2)19(16,17)11-8-9(12(14)15)6-7-10(11)18-3/h6-8H,4-5H2,1-3H3,(H,14,15)

InChI key: InChIKey=AJIWPCKBPCFECV-UHFFFAOYSA-N

SMILES: S(N(CC)CC)(=O)(=O)C1=C(OC)C=CC(C(O)=O)=C1

Synonyms:

• 3-Diethylsulfamoyl-4-methoxy-benzoic acid
• 3-Diethylsulfamoyl-4-methoxybenzoic acid
• 3-[(Diethylamino)sulfonyl]-4-methoxybenzoic acid
• Benzoic acid, 3-[(diethylamino)sulfonyl]-4-methoxy-

3-(Diethylsulfamoyl)-4-methoxybenzoic acid

CAS: 299181-34-3

Versatile small molecule scaffold

Formula: C₁₂H₁₇NO₅S

Purity: Min. 95%

Molecular weight: 287.33 g/mol

Ref: 3D-ZLA18134