CAS 29927-85-3
:octahydro-1H-inden-1-one
Description:
Octahydro-1H-inden-1-one, also known by its CAS number 29927-85-3, is a cyclic ketone characterized by its saturated bicyclic structure. It features a six-membered ring fused to a five-membered ring, which contributes to its unique chemical properties. This compound is typically colorless to pale yellow in appearance and has a relatively low boiling point, indicating it is a volatile substance. Octahydro-1H-inden-1-one is soluble in organic solvents, making it useful in various chemical applications, including as an intermediate in organic synthesis and in the production of fragrances and flavoring agents. Its reactivity is influenced by the presence of the carbonyl group, which can participate in various chemical reactions such as nucleophilic additions. Additionally, the compound's structure allows for potential stereoisomerism, which can affect its physical and chemical properties. Overall, octahydro-1H-inden-1-one is a versatile compound with applications in both industrial and research settings.
Formula:C9H14O
InChI:InChI=1/C9H14O/c10-9-6-5-7-3-1-2-4-8(7)9/h7-8H,1-6H2
Synonyms:- 1-Indanone, hexahydro-
- 1H-Inden-1-one, octahydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Octahydro-1H-inden-1-one
CAS:<p>Octahydro-1H-inden-1-one is an alkylation agent that has been used in the synthesis of triketones and ethyl diazoacetate. This compound is a synthetic intermediate that is used to produce organic compounds. It can be prepared by the kinetic reaction of ethyl diazoacetate with chloride or by the thermolysis of 1,3,5-triketone. Octahydro-1H-inden-1-one can also be synthesized from octahydrobenzofuran using a regiospecifically catalyzed reaction. The compound exists as two regiospecific isomers due to its double bond: cis and trans. The cis form has greater reactivity than the trans form because it has two electron withdrawing groups on the same side of the double bond and it can be hydrolyzed more easily than its trans isomer.<br>Octahydro-1H-ind</p>Formula:C9H14OPurity:Min. 95%Molecular weight:138.21 g/mol
