CymitQuimica logo

CAS 299404-81-2

:

methyl 4-(3-bromophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate

Description:
Methyl 4-(3-bromophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate, identified by its CAS number 299404-81-2, is a chemical compound that belongs to the class of tetrahydropyrimidines. This compound features a pyrimidine ring, which is a six-membered heterocyclic structure containing nitrogen atoms. The presence of a bromophenyl group indicates that it has a bromine substituent on a phenyl ring, contributing to its potential reactivity and biological activity. The methyl ester functional group suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid. The compound's structure includes a carbonyl group, which is indicative of its potential as a reactive intermediate in various chemical reactions. Due to its unique structural features, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific physical properties such as solubility, melting point, and spectral data would require empirical determination or literature reference for detailed characterization.
Formula:C13H13BrN2O3
InChI:InChI=1/C13H13BrN2O3/c1-7-10(12(17)19-2)11(16-13(18)15-7)8-4-3-5-9(14)6-8/h3-6,11H,1-2H3,(H2,15,16,18)
InChI key:YTHBJHRPIHXWEL-UHFFFAOYSA-N
SMILES:CC1=C(C(c2cccc(c2)Br)NC(=N1)O)C(=O)OC
Found 5 products.