CymitQuimica logo

CAS 29947-24-8

:

Thiazole, 2-bromo-4,5-dimethyl-

Description:
Thiazole, 2-bromo-4,5-dimethyl- (CAS 29947-24-8) is a heterocyclic organic compound characterized by a five-membered ring containing both sulfur and nitrogen atoms. The thiazole ring structure is substituted at the 2-position with a bromine atom and at the 4 and 5 positions with methyl groups, which influence its chemical reactivity and physical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. Thiazoles are known for their diverse biological activities, making them of interest in medicinal chemistry and agrochemicals. The presence of the bromine substituent can enhance its reactivity, allowing for further functionalization in synthetic applications. Additionally, the methyl groups contribute to the compound's steric properties, potentially affecting its interactions with biological targets. Overall, 2-bromo-4,5-dimethylthiazole is a valuable compound in research and development, particularly in the fields of pharmaceuticals and materials science.
Formula:C5H6BrNS
InChI:InChI=1S/C5H6BrNS/c1-3-4(2)8-5(6)7-3/h1-2H3
InChI key:SOFNZMRISCENSZ-UHFFFAOYSA-N
SMILES:CC1=C(SC(=N1)Br)C
Synonyms:
  • 2-Bromo-4,5-dimethylthiazole
Found 4 products.