CAS 2996-30-7

2-fluoro-1-iodo-4-nitrobenzene

Description:

2-Fluoro-1-iodo-4-nitrobenzene is an aromatic compound characterized by the presence of a nitro group, a fluorine atom, and an iodine atom attached to a benzene ring. The nitro group (-NO2) is a strong electron-withdrawing group, which influences the reactivity and properties of the compound. The fluorine atom, being highly electronegative, contributes to the compound's overall polarity and can affect its solubility in various solvents. The iodine atom, larger and less electronegative than fluorine, can impart unique reactivity, particularly in nucleophilic substitution reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as both iodine and nitro groups can pose health risks.

Formula: C₆H₃FINO₂

InChI: InChI=1/C6H3FINO2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H

SMILES: c1cc(c(cc1N(=O)=O)F)I

Synonyms:

• Benzene, 2-fluoro-1-iodo-4-nitro-
• 3-Fluoro-4-Iodonitrobenzene
• 1-Fluoro-2-iodo-5-nitrobenzene
• 2-Fluoro-1-iodo-4-nitrobenzene

3-Fluoro-4-iodonitrobenzene

CAS: 2996-30-7

Formula: C₆H₃FINO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 266.9964

Ref: IN-DA00BCJZ

3-Fluoro-4-iodonitrobenzene

CAS: 2996-30-7

3-Fluoro-4-iodonitrobenzene

Formula: C₆H₃FINO₂

Purity: 95%

Color and Shape: yellow to brown solid

Molecular weight: 267.00g/mol

Ref: 54-PC201225

3-Fluoro-4-iodonitrobenzene

CAS: 2996-30-7

Formula: C₆H₃FINO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.998

Ref: 10-F035088