CAS 2996-31-8

2-Fluoro-4-iodonitrobenzene

Description:

2-Fluoro-4-iodonitrobenzene is an aromatic compound characterized by the presence of a nitro group, a fluorine atom, and an iodine atom attached to a benzene ring. Its molecular structure features a nitro group (-NO2) at the para position relative to the iodine atom and a fluorine atom at the meta position. This compound is typically a yellow to orange solid at room temperature and is known for its reactivity due to the presence of both electron-withdrawing groups (the nitro and halogen substituents) and the aromatic system. It is used in various chemical synthesis processes, particularly in the development of pharmaceuticals and agrochemicals. The presence of the fluorine and iodine atoms can influence its physical properties, such as solubility and boiling point, as well as its reactivity in nucleophilic substitution reactions. Additionally, 2-Fluoro-4-iodonitrobenzene is of interest in studies related to the effects of halogen substitution on the electronic properties of aromatic compounds.

Formula: C₆H₃FINO₂

InChI: InChI=1S/C6H3FINO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H

SMILES: c1cc(c(cc1I)F)N(=O)=O

Synonyms:

• 2-Fluoro-4-iodo-1-nitrobenzene
• 3-Fluoro-4-nitroiodobenzene

2-Fluoro-4-iodo-1-nitrobenzene

CAS: 2996-31-8

Formula: C₆H₃FINO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.9964

Ref: IN-DA0037OV

2-Fluoro-4-iodonitrobenzene

CAS: 2996-31-8

2-Fluoro-4-iodonitrobenzene

Formula: C₆H₃FINO₂

Purity: ≥95%

Color and Shape: orange/yellow solid

Molecular weight: 267.00g/mol

Ref: 54-PC49098

2-Fluoro-4-iodo-1-nitrobenzene

CAS: 2996-31-8

Formula: C₆H₃FINO₂

Purity: 95%

Molecular weight: 266.998

Ref: 10-F231179