CAS 29969-57-1

2-Chloro-6-nitroquinoline

Description:

2-Chloro-6-nitroquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the second position and a nitro group at the sixth position of the quinoline ring significantly influences its chemical properties and reactivity. This compound typically appears as a yellow to orange crystalline solid and is known for its potential applications in medicinal chemistry, particularly in the development of antimicrobial and antitumor agents. It exhibits moderate solubility in organic solvents, while its solubility in water is limited. The nitro group contributes to its electrophilic character, making it a potential candidate for further chemical modifications. Additionally, 2-chloro-6-nitroquinoline may exhibit biological activity, which has been the subject of various studies aimed at understanding its mechanism of action and therapeutic potential. As with many chemical substances, appropriate safety measures should be taken when handling this compound due to its potential toxicity and environmental impact.

Formula: C₉H₅ClN₂O₂

InChI: InChI=1S/C9H5ClN2O2/c10-9-4-1-6-5-7(12(13)14)2-3-8(6)11-9/h1-5H

InChI key: InChIKey=FQYXTVZGTFWRGD-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC2=C(N=C(Cl)C=C2)C=C1

Synonyms:

• Quinoline, 2-Chloro-6-Nitro-
• 2-Chloro-6-nitroquinoline

2-Chloro-6-nitroquinoline

CAS: 29969-57-1

Formula: C₉H₅ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.6012

Ref: IN-DA00C4E2

2-Chloro-6-nitroquinoline

CAS: 29969-57-1

2-Chloro-6-nitroquinoline

Formula: C₉H₅ClN₂O₂

Purity: 95%

Color and Shape: grey solid

Molecular weight: 208.60g/mol

Ref: 54-OR927639

2-Chloro-6-nitroquinoline

CAS: 29969-57-1

Formula: C₉H₅ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.6

Ref: 10-F210689