CAS 29973-91-9

4-benzyloxy-3-methoxyphenylacetic acid

Description:

4-Benzyloxy-3-methoxyphenylacetic acid is an organic compound characterized by its aromatic structure and functional groups. It features a phenylacetic acid backbone, which includes a carboxylic acid group (-COOH) that contributes to its acidity and potential reactivity. The presence of a benzyloxy group (-O-Ph) and a methoxy group (-OCH3) on the aromatic ring enhances its lipophilicity and may influence its biological activity. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound may exhibit interesting biological properties, making it a subject of interest for further research in drug development and synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₆H₁₆O₄

InChI: InChI=1/C16H16O4/c1-19-15-9-13(10-16(17)18)7-8-14(15)20-11-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,17,18)

SMILES: COc1cc(ccc1OCc1ccccc1)CC(=O)O

4-Benzyloxy-3-methoxyphenylacetic Acid

CAS: 29973-91-9

Formula: C₁₆H₁₆O₄

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 272.30

Ref: 3B-B4800

4-Benzyloxy-3-methoxyphenylacetic acid

CAS: 29973-91-9

Formula: C₁₆H₁₆O₄

Purity: 98%

Molecular weight: 272.2958

Ref: IN-DA003KTF

4-Benzyloxy-3-methoxyphenylacetic acid

CAS: 29973-91-9

4-Benzyloxy-3-methoxyphenylacetic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 272.30g/mol

Ref: 54-OR42061

4-Benzyloxy-3-methoxyphenylacetic Acid

Controlled Product

CAS: 29973-91-9

Applications 4-Benzyloxy-3-methoxyphenylacetic Acid is a reactant in the synthesis of (+)- and (-)-govadine, which are dopamine D1 and D2 receptor modulators.
References Zhai, H., et. al.: Bioorg. Med. Chem. Lett., 22, 1557 (2012)

Formula: C₁₆H₁₆O₄

Color and Shape: Neat

Molecular weight: 272.3

Ref: TR-B287045

2-(4-(Benzyloxy)-3-methoxyphenyl)acetic acid

CAS: 29973-91-9

Purity: 98%(LC-MS);RG

Molecular weight: 272.2999878

Ref: 10-F619723