CAS 29974-49-0

5,5-dimethyl-2-[(phenylamino)methylidene]cyclohexane-1,3-dione

Description:

5,5-Dimethyl-2-[(phenylamino)methylidene]cyclohexane-1,3-dione, with the CAS number 29974-49-0, is an organic compound characterized by its complex structure, which includes a cyclohexane ring substituted with two methyl groups and a phenylamino group. This compound features a diketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the phenylamino moiety suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as condensation or nucleophilic substitution. The compound's structure allows for potential interactions with biological systems, making it a candidate for further investigation in medicinal chemistry. Additionally, its physical properties, such as solubility and melting point, would depend on the specific conditions and solvent used. Overall, 5,5-dimethyl-2-[(phenylamino)methylidene]cyclohexane-1,3-dione represents a versatile scaffold for the development of new chemical entities in research and industry.

Formula: C₁₅H₁₇NO₂

InChI: InChI=1/C15H17NO2/c1-15(2)8-13(17)12(14(18)9-15)10-16-11-6-4-3-5-7-11/h3-7,10,16H,8-9H2,1-2H3

SMILES: CC1(C)CC(=O)C(=CNc2ccccc2)C(=O)C1

Synonyms:

• 1,3-Cyclohexanedione, 5,5-dimethyl-2-[(phenylamino)methylene]-
• 2-(Anilinomethylene)-5,5-dimethylcyclohexane-1,3-dione

5,5-Dimethyl-2-[(phenylamino)methylidene]cyclohexane-1,3-dione

CAS: 29974-49-0

5,5-Dimethyl-2-[(phenylamino)methylidene]cyclohexane-1,3-dione

Purity: tech

Molecular weight: 243.30g/mol

Ref: 54-OR33041

5,5-Dimethyl-2-[(phenylamino)methylidene]cyclohexane-1,3-dione

CAS: 29974-49-0

5,5-Dimethyl-2-[(phenylamino)methylidene]cyclohexane-1,3-dione is a high quality reagent that can be used as an intermediate in the synthesis of various biologically active compounds. This compound has been shown to be a useful building block and scaffold for the synthesis of complex molecules. It is also a versatile building block with many possible reactions. 5,5-Dimethyl-2-[(phenylamino)methylidene]cyclohexane-1,3-dione has been shown to react with a variety of reagents including alcohols, amines, thiols and halides to form new products.

Formula: C₁₅H₁₇NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 243.31 g/mol

Ref: 3D-EBA97449