CAS 29976-82-7

1-(2-hydroxy-5-methylphenyl)-3-phenyl-1,3-propane

Description:

1-(2-Hydroxy-5-methylphenyl)-3-phenyl-1,3-propane, identified by its CAS number 29976-82-7, is an organic compound characterized by its complex structure featuring a propane backbone substituted with a hydroxyl group and phenyl rings. This compound typically exhibits properties associated with phenolic compounds, including potential antioxidant activity due to the presence of the hydroxyl group. The molecular structure suggests it may have applications in various fields, including pharmaceuticals and materials science, owing to its potential reactivity and ability to form hydrogen bonds. The presence of multiple aromatic rings may contribute to its stability and influence its solubility in organic solvents. Additionally, the compound's specific interactions and behavior in chemical reactions would depend on factors such as pH, temperature, and the presence of other reagents. Overall, 1-(2-hydroxy-5-methylphenyl)-3-phenyl-1,3-propane represents a class of compounds that can be studied for their unique chemical properties and potential applications.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c1-11-7-8-14(17)13(9-11)16(19)10-15(18)12-5-3-2-4-6-12/h2-10,17-18H,1H3

SMILES: Cc1ccc(c(c1)C(=O)C=C(c1ccccc1)O)O

Synonyms:

• 1-(2-Hydroxy-5-methylphenyl)-3-phenyl-1,3-propanedione
• 1-(2-Hydroxy-5-Methylphenyl)-3-Phenylpropane-1,3-Dione
• 3-Hydroxy-1-(2-Hydroxy-5-Methylphenyl)-3-Phenylprop-2-En-1-One

1-(2-hydroxy-5-methylphenyl)-3-phenylpropane-1,3-dione

CAS: 29976-82-7

1-(2-hydroxy-5-methylphenyl)-3-phenylpropane-1,3-dione

Purity: 97%

Molecular weight: 254.28g/mol

Ref: 54-OR24737