CAS 300-48-1
:3-Methoxy-L-tyrosine
Description:
3-Methoxy-L-tyrosine, also known as homovanillic acid, is an amino acid derivative characterized by the presence of a methoxy group attached to the aromatic ring of the tyrosine structure. It is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. This compound is notable for its role in the metabolism of catecholamines and is often studied in the context of neurological research, particularly concerning its potential implications in dopamine metabolism. 3-Methoxy-L-tyrosine exhibits properties such as solubility in water and organic solvents, which can vary based on pH and concentration. Its molecular structure includes a phenolic hydroxyl group, contributing to its reactivity and potential antioxidant properties. Additionally, it may serve as a biomarker in certain medical conditions, particularly in the assessment of neuroendocrine tumors. Overall, 3-Methoxy-L-tyrosine is a significant compound in both biochemical research and clinical studies, highlighting its relevance in understanding various physiological processes.
Formula:C10H13NO4
InChI:InChI=1S/C10H13NO4/c1-15-9-5-6(2-3-8(9)12)4-7(11)10(13)14/h2-3,5,7,12H,4,11H2,1H3,(H,13,14)/t7-/m0/s1
InChI key:InChIKey=PFDUUKDQEHURQC-ZETCQYMHSA-N
SMILES:C([C@@H](C(O)=O)N)C1=CC(OC)=C(O)C=C1
Synonyms:- (2S)-2-Amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid
- (S)-2-Amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid
- 2-Amino-3-(4-hydroxy-3-(methoxyl)phenyl)propanoic acid
- 3-(4-hydroxy-3-methoxyphenyl)-L-alanine
- 3-Methoxy-4-hydroxyphenylalanine
- 3-Methoxy-<span class="text-smallcaps">L</span>-tyrosine
- 3-Methoxy-DOPA
- 3-Methoxytyrosine
- 3-O-Methyl-<span class="text-smallcaps">L</span>-DOPA
- 3-O-methyldopa
- 3-methoxy-L-tyrosine
- <span class="text-smallcaps">L</span>-3-Methoxy-4-hydroxyphenylalanine
- <span class="text-smallcaps">L</span>-3-O-Methyl-DOPA
- <span class="text-smallcaps">L</span>-4-Hydroxy-3-methoxyphenylalanine
- <span class="text-smallcaps">L</span>-Tyrosine, 3-methoxy-
- Tyrosine, 3-methoxy-, <span class="text-smallcaps">L</span>-
- 3-O-Methyl-L-DOPA
- L-Tyrosine, 3-methoxy-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Levodopa EP Impurity C (S-Isomer) (L-3-O-Methyldopa)
CAS:Formula:C10H13NO4Color and Shape:White To Off-White SolidMolecular weight:211.22(2S)-2-Amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid
CAS:Controlled ProductL-DOPA is a natural amino acid and intermediate in the biosynthesis of dopamine. It is also a precursor for the synthesis of norepinephrine from dopamine. L-DOPA is synthesized from the amino acid tyrosine by the enzyme tyrosine hydroxylase. It can be used as a drug to treat Parkinson's disease and other disorders that affect motor function, such as Huntington's disease and Tourette syndrome. L-DOPA is converted to dopamine by the enzyme dopa decarboxylase, which converts it to dopamine in a two-step process. The conversion of L-DOPA to dopamine can be monitored using electrochemical detection or fluorescence spectroscopy.Formula:C10H13NO4Purity:Min. 95%Molecular weight:211.21 g/mol



