CymitQuimica logo

CAS 3001303-50-7

:

Revefenacin Impurity 19 Formate

Description:
Revefenacin Impurity 19 Formate, identified by the CAS number 3001303-50-7, is a chemical compound that serves as an impurity associated with the pharmaceutical substance Revefenacin, which is used as a bronchodilator for the treatment of chronic obstructive pulmonary disease (COPD). As an impurity, it may arise during the synthesis or storage of the primary compound. The characteristics of this substance typically include its molecular structure, which may involve specific functional groups that influence its chemical behavior and stability. Impurities like Revefenacin Impurity 19 Formate are often characterized by their solubility in various solvents, melting and boiling points, and spectroscopic properties such as NMR, IR, and mass spectrometry profiles. Understanding the characteristics of such impurities is crucial for quality control in pharmaceutical manufacturing, as they can affect the efficacy and safety of the final drug product. Regulatory guidelines often require detailed profiling of impurities to ensure compliance with safety standards.
Formula:C35H43N5O5
InChI:InChI=1S/C35H43N5O5/c1-38(34(42)29-13-11-26(12-14-29)25-39-19-15-28(16-20-39)33(36)41)21-24-40(44)22-17-30(18-23-40)45-35(43)37-32-10-6-5-9-31(32)27-7-3-2-4-8-27/h2-14,28,30H,15-25H2,1H3,(H2,36,41)(H,37,43)
InChI key:QCPCRWALXDVBPJ-UHFFFAOYSA-N
SMILES:CN(CC[N+]1(CCC(CC1)OC(=O)NC2=CC=CC=C2C3=CC=CC=C3)[O-])C(=O)C4=CC=C(C=C4)CN5CCC(CC5)C(=O)N
Synonyms:
  • Revefenacin Impurity 19 Formate
Found 2 products.