CAS 30015-57-7
:2,2,6,6-tetramethyl-1-azabicyclo[2.2.2]octane hydrobromide (1:1)
Description:
2,2,6,6-Tetramethyl-1-azabicyclo[2.2.2]octane hydrobromide, with the CAS number 30015-57-7, is a quaternary ammonium compound characterized by its bicyclic structure, which incorporates a nitrogen atom within a bicyclo[2.2.2]octane framework. This compound features four methyl groups attached to the nitrogen and carbon atoms, contributing to its steric bulk and lipophilicity. As a hydrobromide salt, it is typically encountered in a solid form and is soluble in polar solvents. The presence of the quaternary ammonium group imparts cationic properties, making it useful in various applications, including as a surfactant or in organic synthesis. Its unique structure may also influence its biological activity, potentially serving as a ligand or in drug design. Safety data should be consulted for handling, as quaternary ammonium compounds can exhibit toxicity and irritant properties. Overall, 2,2,6,6-tetramethyl-1-azabicyclo[2.2.2]octane hydrobromide is notable for its distinctive bicyclic architecture and potential utility in chemical and pharmaceutical contexts.
Formula:C11H22BrN
InChI:InChI=1/C11H21N.BrH/c1-10(2)7-9-5-6-12(10)11(3,4)8-9;/h9H,5-8H2,1-4H3;1H
SMILES:CC1(C)CC2CCN1C(C)(C)C2.Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Temechine hydrobromide
CAS:Temechine hydrobromide is used for the identification of new diterpenoidal alkaloid leads as tyrosinase inhibitors.Formula:C11H22BrNColor and Shape:SolidMolecular weight:248.21
