CAS 3002-81-1
:5,6-Dimethyl-1,10-phenanthroline
Description:
5,6-Dimethyl-1,10-phenanthroline is an organic compound characterized by its structure, which includes a phenanthroline backbone with two methyl groups attached at the 5 and 6 positions. This compound is known for its chelating properties, particularly with transition metals, making it useful in various analytical and coordination chemistry applications. It typically exhibits strong fluorescence, which can be advantageous in detection and sensing applications. The presence of the dimethyl groups enhances its solubility in organic solvents, facilitating its use in diverse chemical environments. Additionally, 5,6-Dimethyl-1,10-phenanthroline can participate in redox reactions, contributing to its utility in electrochemical studies. Its stability and reactivity can vary depending on the surrounding conditions, such as pH and the presence of other ligands. Overall, this compound is significant in research and industrial applications, particularly in the fields of coordination chemistry and materials science.
Formula:C14H12N2
InChI:InChI=1/C14H12N2/c1-9-10(2)12-6-4-8-16-14(12)13-11(9)5-3-7-15-13/h3-8H,1-2H3
InChI key:InChIKey=BRPQDJPJBCQFSR-UHFFFAOYSA-N
SMILES:CC1=C2C(=C3C(=C1C)C=CC=N3)N=CC=C2
Synonyms:- 1,10-Phenanthroline, 5,6-dimethyl-
- 5 6-Dimethyl-1,10-Phenanthroline Acs
- 5,6-Dimethyl-o-phenanthroline
- 5,6-Dimethyl-1,10-phenanthroline
- 5,6-dimethyl-10-phenanthroline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5,6-Dimethyl-1,10-phenanthroline
CAS:Formula:C14H12N2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:208.265,6-Dimethyl-1,10-phenanthroline
CAS:Formula:C14H12N2Purity:96%Color and Shape:SolidMolecular weight:208.25855,6-Dimethyl-1,10-phenanthroline
CAS:5,6-Dimethyl-1,10-phenanthrolinePurity:98%Molecular weight:208.26g/mol5,6-Dimethyl-1,10-phenanthroline
CAS:5,6-Dimethyl-1,10-phenanthrolinePurity:98%Molecular weight:208.26g/mol5,6-Dimethyl-1,10-phenanthroline
CAS:Formula:C14H12N2Purity:96%Color and Shape:SolidMolecular weight:208.2645,6-Dimethyl-1,10-phenanthroline
CAS:5,6-Dimethyl-1,10-phenanthroline (DMPA) is a molecule with the chemical formula H2C8N4O2. It has been shown to have antioxidant and anticancer properties. DMPA binds to DNA to form an adduct that denatures the DNA. This prevents DNA from being transcribed into RNA, which prevents gene expression and cell division. The anticancer activity of DMPA may be due to its ability to increase oxidative dna damage in cancer cells, leading to apoptosis. DMPA has also been shown to bind redox potentials of metals such as copper, iron and nickel that are found in the environment or in cancer cells. This binding alters the electron transfer reactions involving these metals and leads to a change in the viscosity of the solution. The molecular modeling studies have shown that DMPA binds with nitrogen atoms in coordination geometry with oxygen atoms on two sites on one molecule (see Figure 1). This binding is characterized byFormula:C14H12N2Purity:Min. 95%Color and Shape:PowderMolecular weight:208.26 g/mol





