CymitQuimica logo

CAS 30021-74-0

:

C15 H24,

Description:
The chemical substance with the formula C15H24 and CAS number 30021-74-0 is known as 1,3,5-Cyclohexadecatriene. It is a hydrocarbon belonging to the class of alkenes, characterized by the presence of multiple double bonds within its structure. This compound typically exhibits a non-polar nature, making it insoluble in water but soluble in organic solvents. Its molecular structure suggests it may have a relatively high boiling point compared to alkanes of similar molecular weight due to the presence of double bonds, which can influence its physical properties. Additionally, the presence of multiple double bonds can impart reactivity, allowing it to participate in various chemical reactions, such as polymerization or hydrogenation. The compound may also have applications in organic synthesis or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13-15H,4-8H2,1-3H3/t13-,14+,15-/m0/s1
InChI key:WRHGORWNJGOVQY-ZNMIVQPWSA-N
SMILES:CC1=C[C@@H]2[C@H](CC1)C(=C)CC[C@H]2C(C)C
Synonyms:
  • C15 H24,
  • (1à,4aà,8aà)-1,2,3,4,4a,5,6,8a-Octahydro-7-methyl-4-methylene-1-(1-methylethyl)-naphthalene
  • Naphthalene, 1,2,3,4,4a,5,6,8a-octahydro-7-methyl-4-methylene-1-(1-methylethyl)-, (1R,4aR,8aS)-rel-
  • γ-Muurolene
Found 4 products.