CymitQuimica logo

CAS 30034-02-7

:

sodium (6R,7R)-7-{[(2R)-2-hydroxy-2-phenylacetyl]amino}-3-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate

Description:
The chemical substance known as sodium (6R,7R)-7-{[(2R)-2-hydroxy-2-phenylacetyl]amino}-3-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate, with the CAS number 30034-02-7, is a complex organic compound that belongs to the class of thiazolidine derivatives. It features a bicyclic structure, which contributes to its unique chemical properties. The presence of multiple functional groups, including a carboxylate, an amine, and a thiadiazole moiety, suggests potential biological activity, possibly as an antibiotic or antimicrobial agent. The sodium salt form indicates that it is likely soluble in water, enhancing its bioavailability. The stereochemistry, indicated by the (6R,7R) configuration, may influence its interaction with biological targets. Overall, this compound's intricate structure and functional diversity make it a subject of interest in medicinal chemistry and pharmacology, although specific applications and biological effects would require further investigation.
Formula:C19H17N4NaO5S3
InChI:InChI=1/C19H18N4O5S3.Na/c1-9-21-22-19(31-9)30-8-11-7-29-17-12(16(26)23(17)13(11)18(27)28)20-15(25)14(24)10-5-3-2-4-6-10;/h2-6,12,14,17,24H,7-8H2,1H3,(H,20,25)(H,27,28);/q;+1/p-1/t12-,14-,17-;/m1./s1
SMILES:Cc1nnc(SCC2=C(C(=O)O)N3C(=O)C(C3SC2)N=C(C(c2ccccc2)O)O)s1.[Na]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.