
CAS 300347-11-9
:4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-[(2E)-3-(3-methoxy-2-nitrophenyl)-2-propen-1-yl]piperidine
Description:
The chemical substance known as 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-[(2E)-3-(3-methoxy-2-nitrophenyl)-2-propen-1-yl]piperidine, with the CAS number 300347-11-9, is a complex organic compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with a dibenzo[a,d]cycloheptene moiety, contributing to its polycyclic nature. The presence of a methoxy group and a nitrophenyl group indicates potential for various chemical interactions, including electrophilic substitution and hydrogen bonding. This compound may exhibit interesting biological activities due to its structural complexity, making it a candidate for research in medicinal chemistry. Its synthesis and reactivity can be influenced by the functional groups present, which may also affect its solubility, stability, and overall chemical behavior. As with many organic compounds, understanding its properties requires consideration of its molecular interactions and potential applications in pharmaceuticals or materials science.
Formula:C30H28N2O3
InChI:InChI=1S/C30H28N2O3/c1-35-28-14-6-10-25(30(28)32(33)34)11-7-19-31-20-17-24(18-21-31)29-26-12-4-2-8-22(26)15-16-23-9-3-5-13-27(23)29/h2-16H,17-21H2,1H3/b11-7+
InChI key:InChIKey=HLPYTHVNPSSCNQ-YRNVUSSQSA-N
SMILES:C(/C=C/C1=C(N(=O)=O)C(OC)=CC=C1)N2CCC(=C3C=4C(C=CC=5C3=CC=CC5)=CC=CC4)CC2
Synonyms:- Piperidine, 4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-[(2E)-3-(3-methoxy-2-nitrophenyl)-2-propenyl]-
- Piperidine, 4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-[(2E)-3-(3-methoxy-2-nitrophenyl)-2-propen-1-yl]-
- 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-[(2E)-3-(3-methoxy-2-nitrophenyl)-2-propen-1-yl]piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AH-1058 free base
CAS:<p>AH-1058 free base is a biochemical.</p>Formula:C30H28N2O3Color and Shape:SolidMolecular weight:464.55
