CAS 300358-31-0

2-(4-hydrazino-6-methylpyrimidin-2-yl)phenol

Description:

2-(4-Hydrazino-6-methylpyrimidin-2-yl)phenol is a chemical compound characterized by its unique structure, which includes a phenolic group and a hydrazine moiety attached to a pyrimidine ring. This compound typically exhibits properties associated with both hydrazines and phenols, such as potential reactivity due to the presence of the hydrazine functional group, which can participate in various chemical reactions, including condensation and oxidation. The pyrimidine ring contributes to its aromaticity and may influence its biological activity. The compound may also exhibit solubility in polar solvents due to the presence of the hydroxyl group in the phenol part of the molecule. Its specific applications can vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic properties, including antimicrobial or anticancer activities. Safety and handling precautions should be observed, as hydrazine derivatives can be toxic and potentially hazardous.

Formula: C₁₁H₁₂N₄O

InChI: InChI=1/C11H12N4O/c1-7-6-10(15-12)14-11(13-7)8-4-2-3-5-9(8)16/h2-6,16H,12H2,1H3,(H,13,14,15)

SMILES: Cc1cc(nc(c2ccccc2O)n1)NN

Synonyms:

• 2-(4-Hydrazino-6-methyl-pyrimidin-2-yl)-phenol

2-(4-Hydrazino-6-methylpyrimidin-2-yl)phenol

CAS: 300358-31-0

Formula: C₁₁H₁₂N₄O

Purity: 95.0%

Molecular weight: 216.244

Ref: 10-F061309