CAS 30038-31-4
:2,4,5-trimethoxybenzyl alcohol
Description:
2,4,5-Trimethoxybenzyl alcohol is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with three methoxy groups and a hydroxymethyl group. The presence of these methoxy groups contributes to its solubility in organic solvents and influences its reactivity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It has a relatively low melting point and boiling point, indicative of its molecular weight and structure. The hydroxyl group in benzyl alcohol makes it a primary alcohol, which can participate in various chemical reactions, including oxidation and esterification. Additionally, the methoxy groups can enhance its electron-donating properties, potentially affecting its behavior in electrophilic aromatic substitution reactions. 2,4,5-Trimethoxybenzyl alcohol may also exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its CAS number, 30038-31-4, is a unique identifier that facilitates its recognition in scientific literature and databases.
Formula:C10H14O4
InChI:InChI=1/C10H14O4/c1-12-8-5-10(14-3)9(13-2)4-7(8)6-11/h4-5,11H,6H2,1-3H3
SMILES:COc1cc(c(cc1CO)OC)OC
Synonyms:- (2,4,5-Trimethoxyphenyl)Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,4,5-Trimethoxybenzyl alcohol
CAS:<p>2,4,5-Trimethoxybenzyl alcohol is a metabolite that is produced by the p. pastoris strain. It has been shown to be active against the enzyme glyceraldehyde-3-phosphate dehydrogenase and has been expressed heterologously in yeast. 2,4,5-Trimethoxybenzyl alcohol also has been shown to inhibit peroxidases and may have biochemical applications in pharmaceuticals as an inhibitor of lipid peroxidation.</p>Formula:C10H14O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:198.22 g/mol
