CAS 300390-93-6
:[4-(4-aminophenyl)-1H-imidazol-1-yl]acetic acid
Description:
[4-(4-Aminophenyl)-1H-imidazol-1-yl]acetic acid, with the CAS number 300390-93-6, is a chemical compound characterized by its imidazole and amino phenyl functional groups. This substance features an imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms, contributing to its potential biological activity. The presence of the amino group (-NH2) on the phenyl ring enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The acetic acid moiety provides acidic properties, allowing for potential interactions in biochemical pathways. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in areas such as anti-inflammatory or antimicrobial therapies, although specific biological activities would require empirical investigation. Overall, [4-(4-aminophenyl)-1H-imidazol-1-yl]acetic acid represents a versatile scaffold for further chemical modifications and research into its therapeutic potential.
Formula:C11H11N3O2
InChI:InChI=1/C11H11N3O2/c12-9-3-1-8(2-4-9)10-5-14(7-13-10)6-11(15)16/h1-5,7H,6,12H2,(H,15,16)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.